Tyrphostin AG 537
Modify Date: 2026-04-15 14:47:43
Tyrphostin AG 537 structure
|
Common Name | Tyrphostin AG 537 | ||
|---|---|---|---|---|
| CAS Number | 140674-77-7 | Molecular Weight | 448.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tyrphostin AG 537 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H20N4O6 |
|---|---|
| Molecular Weight | 448.4 |
| InChIKey | ZHOKHSGWBNPFQU-GONBZBRSSA-N |
| SMILES | C1=CC(=C(C=C1/C=C(/C(=O)NCCCNC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N)\C#N)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 106, Current Page 1 of 11
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tyrphostin AG 537? |
| A: The English name of Tyrphostin AG 537 is Tyrphostin AG 537. |
| Q: What is the Chinese name of 140674-77-7? |
| A: Chinese name of 140674-77-7 is 140674-77-7. |
| Q: What is the molecular formula of Tyrphostin AG 537? |
| A: Molecular formula of Tyrphostin AG 537 is C23H20N4O6. |
| Q: What is the SMILES notation of Tyrphostin AG 537? |
| A: SMILES notation of Tyrphostin AG 537 is C1=CC(=C(C=C1/C=C(/C(=O)NCCCNC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N)\C#N)O)O. |
| Q: What is the CAS number of Tyrphostin AG 537? |
| A: CAS number of Tyrphostin AG 537 is 140674-77-7. |
| Q: What is the InChIKey of Tyrphostin AG 537? |
| A: InChIKey of Tyrphostin AG 537 is ZHOKHSGWBNPFQU-GONBZBRSSA-N. |
| Q: What is the molecular weight of Tyrphostin AG 537? |
| A: Molecular weight of Tyrphostin AG 537 is 448.4. |