3'-DMTr-dA structure
|
Common Name | 3'-DMTr-dA | ||
|---|---|---|---|---|
| CAS Number | 140712-82-9 | Molecular Weight | 857.93 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H52N7O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-DMTr-dA3'-DMTr-dA can be used for the synthesis of nucleotides[1]. |
| Name | (n6-benzoyl)-5'-o-[(n,n-diisopropylamino)-(2-cyanoethoxy)phosphinyl]-3'-o-(4,4'-dimethoxytrityl)-2'-deoxyadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-DMTr-dA can be used for the synthesis of nucleotides[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Huang, et al. Dimeric nucleotide and synthesis method. CN114014902 A. 2022-02-08 |
| Molecular Formula | C47H52N7O7P |
|---|---|
| Molecular Weight | 857.93 |
| Exact Mass | 857.36700 |
| PSA | 168.70000 |
| LogP | 9.12618 |
| InChIKey | JMABKCCHUAJFJE-AKWFTNRHSA-N |
| SMILES | COc1ccc(C(OC2CC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)OC2COP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| N-Benzoyl-5'-O-[(diisopropylaMino)-(2-cyanoethoxy)phosphinyl]-3'-O-(4,4'-diMethoxytrityl)-2'-deoxyadenosine |