2,2'-dihydroxy-3,3'-di-tert-butyl-5,5'-dimethoxydiphenyl structure
|
Common Name | 2,2'-dihydroxy-3,3'-di-tert-butyl-5,5'-dimethoxydiphenyl | ||
|---|---|---|---|---|
| CAS Number | 14078-41-2 | Molecular Weight | 358.47100 | |
| Density | 1.076±0.06 g/cm3(Predicted) | Boiling Point | 464.2±45.0 °C(Predicted) | |
| Molecular Formula | C22H30O4 | Melting Point | 228 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3'-bis(1,1-dimethylethyl)-5,5'-dimethoxy-(1,1'-Biphenyl)-2,2'-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 464.2±45.0 °C(Predicted) |
| Melting Point | 228 °C |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.47100 |
| Exact Mass | 358.21400 |
| PSA | 58.92000 |
| LogP | 5.37700 |
| Vapour Pressure | 3.08E-09mmHg at 25°C |
| InChIKey | CBYWHFTZNVZQHV-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| HS Code | 2922299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01112111 |