1-(4-bromophenyl)-3-[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]thiourea structure
|
Common Name | 1-(4-bromophenyl)-3-[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]thiourea | ||
|---|---|---|---|---|
| CAS Number | 140835-40-1 | Molecular Weight | 423.35400 | |
| Density | 1.54g/cm3 | Boiling Point | 527.5ºC at 760mmHg | |
| Molecular Formula | C15H15BrN6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.8ºC | |
| Name | 1-(4-bromophenyl)-3-[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 527.5ºC at 760mmHg |
| Molecular Formula | C15H15BrN6S2 |
| Molecular Weight | 423.35400 |
| Flash Point | 272.8ºC |
| Exact Mass | 421.99800 |
| PSA | 151.63000 |
| LogP | 4.22030 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | PLRAKQJJYGZNGQ-VXLYETTFSA-N |
| SMILES | CC(=NNC(=S)NNC(=S)Nc1ccc(Br)cc1)c1ccccn1 |
|
~98%
1-(4-bromopheny... CAS#:140835-40-1 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
|
~%
1-(4-bromopheny... CAS#:140835-40-1 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Carbonothioic dihydrazide,N''-(((4-bromophenyl)amino)thioxomethyl)-N'''-((1E)-1-(2-pyridinyl)ethylidene) |