1-[(2-chlorophenyl)carbamothioylamino]-3-[(E)-1-pyridin-2-ylethylideneamino]urea structure
|
Common Name | 1-[(2-chlorophenyl)carbamothioylamino]-3-[(E)-1-pyridin-2-ylethylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 140835-41-2 | Molecular Weight | 362.83700 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15ClN6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2-chlorophenyl)carbamothioylamino]-3-[(E)-1-pyridin-2-ylethylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C15H15ClN6OS |
| Molecular Weight | 362.83700 |
| Exact Mass | 362.07200 |
| PSA | 133.06000 |
| LogP | 3.86650 |
| Index of Refraction | 1.674 |
| InChIKey | VCVUIETUULEIFI-VXLYETTFSA-N |
| SMILES | CC(=NNC(=O)NNC(=S)Nc1ccccc1Cl)c1ccccn1 |
|
~99%
1-[(2-chlorophe... CAS#:140835-41-2 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
|
~%
1-[(2-chlorophe... CAS#:140835-41-2 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Carbonic dihydrazide,N''-(((2-chlorophenyl)amino)thioxomethyl)-N'''-((1E)-1-(2-pyridinyl)ethylidene) |