(3E)-1-(2-chlorophenyl)-3-[[[(1E)-1-(1-hydroxypyridin-2-ylidene)ethyl]amino]carbamothioylimino]thiourea structure
|
Common Name | (3E)-1-(2-chlorophenyl)-3-[[[(1E)-1-(1-hydroxypyridin-2-ylidene)ethyl]amino]carbamothioylimino]thiourea | ||
|---|---|---|---|---|
| CAS Number | 140835-43-4 | Molecular Weight | 394.90200 | |
| Density | 1.43g/cm3 | Boiling Point | 509.8ºC at 760 mmHg | |
| Molecular Formula | C15H15ClN6OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | (3E)-1-(2-chlorophenyl)-3-[[[(1E)-1-(1-hydroxypyridin-2-ylidene)ethyl]amino]carbamothioylimino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760 mmHg |
| Molecular Formula | C15H15ClN6OS2 |
| Molecular Weight | 394.90200 |
| Flash Point | 262.1ºC |
| Exact Mass | 394.04400 |
| PSA | 164.23000 |
| LogP | 4.03900 |
| Vapour Pressure | 3.24E-11mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | DWYDXNYGCPABIZ-OWYUXPLGSA-N |
| SMILES | CC(NNC(=S)N=NC(=S)Nc1ccccc1Cl)=C1C=CC=CN1O |
|
~83%
(3E)-1-(2-chlor... CAS#:140835-43-4 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
|
~%
(3E)-1-(2-chlor... CAS#:140835-43-4 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Carbonothioic dihydrazide,N''-(((2-chlorophenyl)amino)thioxomethyl)-N'''-((1E)-1-(1-oxido-2-pyridinyl)ethylidene) |
| 2-acetylpyridine 5-<(2-chloroanilino)thiocarbonyl>thiocarbonohydrazone 1-oxide |