3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid
Modify Date: 2025-09-12 09:56:56
3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid structure
|
Common Name | 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1408994-31-9 | Molecular Weight | 274.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9F3O2S |
|---|---|
| Molecular Weight | 274.26 |
| InChIKey | VXUUXQPQVNCCHX-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1csc2ccccc12)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: Molecular formula of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is C12H9F3O2S. |
| Q: What is the InChIKey of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: InChIKey of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is VXUUXQPQVNCCHX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: Molecular weight of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is 274.26. |
| Q: What is the English name of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: The English name of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid. |
| Q: What is the Chinese name of 1408994-31-9? |
| A: Chinese name of 1408994-31-9 is 1408994-31-9. |
| Q: What is the CAS number of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: CAS number of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is 1408994-31-9. |
| Q: What is the SMILES notation of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid? |
| A: SMILES notation of 3-(1-Benzothiophen-3-yl)-4,4,4-trifluorobutanoic acid is O=C(O)CC(c1csc2ccccc12)C(F)(F)F. |