α-[[(3-Methoxypropyl)amino]methyl]-α-methyl-1,4-benzodioxane-2-methanol structure
|
Common Name | α-[[(3-Methoxypropyl)amino]methyl]-α-methyl-1,4-benzodioxane-2-methanol | ||
|---|---|---|---|---|
| CAS Number | 14091-01-1 | Molecular Weight | 281.34700 | |
| Density | 1.139g/cm3 | Boiling Point | 426.6ºC at 760mmHg | |
| Molecular Formula | C15H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8ºC | |
| Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-(3-methoxypropylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 426.6ºC at 760mmHg |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.34700 |
| Flash Point | 211.8ºC |
| Exact Mass | 281.16300 |
| PSA | 59.95000 |
| LogP | 1.59440 |
| Vapour Pressure | 4.9E-08mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | VPZPJLDAURVTHC-UHFFFAOYSA-N |
| SMILES | COCCCNCC(C)(O)C1COc2ccccc2O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3182 i.s |