1-N,2-N-bis(7-chloroquinolin-4-yl)cyclohexane-1,2-diamine structure
|
Common Name | 1-N,2-N-bis(7-chloroquinolin-4-yl)cyclohexane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 140926-77-8 | Molecular Weight | 437.36400 | |
| Density | 1.388g/cm3 | Boiling Point | 651.5ºC at 760 mmHg | |
| Molecular Formula | C24H22Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.8ºC | |
| Name | 1-N,2-N-bis(7-chloroquinolin-4-yl)cyclohexane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 651.5ºC at 760 mmHg |
| Molecular Formula | C24H22Cl2N4 |
| Molecular Weight | 437.36400 |
| Flash Point | 347.8ºC |
| Exact Mass | 436.12200 |
| PSA | 49.84000 |
| LogP | 7.07100 |
| Vapour Pressure | 7.45E-17mmHg at 25°C |
| Index of Refraction | 1.746 |
| InChIKey | HNCDFQHKLKELPS-QZTJIDSGSA-N |
| SMILES | Clc1ccc2c(NC3CCCC(Nc4ccnc5cc(Cl)ccc45)C3)ccnc2c1 |
|
~73%
1-N,2-N-bis(7-c... CAS#:140926-77-8 |
| Literature: Vennerstrom, Jonathan L.; Ellis, William Y.; Ager, Arba L.; Andersen, Steven L.; Gerena, Lucia; Milhous, Wilbur K. Journal of Medicinal Chemistry, 1992 , vol. 35, # 11 p. 2129 - 2134 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+/-)-trans-N1,N2-bis(7-chloroquinolin-4-yl)cyclohexane-1,2-diamine |
| 1,3-Cyclohexanediamine,N,N'-bis(7-chloro-4-quinolinyl)-,trans-(9CI) |