2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid
Modify Date: 2026-07-09 22:34:16
![2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/392/1410132-16-9.png)
2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid structure
|
Common Name | 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1410132-16-9 | Molecular Weight | 241.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO4 |
|---|---|
| Molecular Weight | 241.28 |
| InChIKey | DQGCRZXRSJUSSZ-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)NC1(C(=O)O)CCCCC1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: Molecular formula of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is C12H19NO4. |
| Q: What is the English name of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: The English name of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid. |
| Q: What is the Chinese name of 1410132-16-9? |
| A: Chinese name of 1410132-16-9 is 1410132-16-9. |
| Q: What is the SMILES notation of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: SMILES notation of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is C=CCOC(=O)NC1(C(=O)O)CCCCC1C. |
| Q: What is the molecular weight of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: Molecular weight of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is 241.28. |
| Q: What is the CAS number of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: CAS number of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is 1410132-16-9. |
| Q: What is the InChIKey of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid? |
| A: InChIKey of 2-Methyl-1-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclohexane-1-carboxylic acid is DQGCRZXRSJUSSZ-UHFFFAOYSA-N. |