Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl
Modify Date: 2026-06-27 17:22:50
Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl structure
|
Common Name | Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl | ||
|---|---|---|---|---|
| CAS Number | 141018-17-9 | Molecular Weight | 308.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20N4O4 |
|---|---|
| Molecular Weight | 308.33 |
| InChIKey | SVXMBRJJAFLTTL-UHFFFAOYSA-N |
| SMILES | C1CC(OC1CO)N2C=CC(=NC2=O)N=CN3CCOCC3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Half-life in potassium phosphate buffered saline(PBS) at 37 degree C.
Source: ChEMBL
Target: N/A
External Id: CHEMBL637091
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: The English name of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl. |
| Q: What is the molecular formula of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: Molecular formula of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is C14H20N4O4. |
| Q: What is the Chinese name of 141018-17-9? |
| A: Chinese name of 141018-17-9 is 141018-17-9. |
| Q: What is the SMILES notation of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: SMILES notation of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is C1CC(OC1CO)N2C=CC(=NC2=O)N=CN3CCOCC3. |
| Q: What is the CAS number of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: CAS number of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is 141018-17-9. |
| Q: What is the molecular weight of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: Molecular weight of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is 308.33. |
| Q: What is the InChIKey of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl? |
| A: InChIKey of Cytidine, 2',3'-dideoxy-N-[(4-morpholinyl)methyl is SVXMBRJJAFLTTL-UHFFFAOYSA-N. |