5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid structure
|
Common Name | 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1410183-01-5 | Molecular Weight | 237.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO5 |
|---|---|
| Molecular Weight | 237.21 |
| InChIKey | NHVUZWBFTBIVET-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)Nc1ccc(O)cc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: Molecular formula of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is C11H11NO5. |
| Q: What is the SMILES notation of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: SMILES notation of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is C=CCOC(=O)Nc1ccc(O)cc1C(=O)O. |
| Q: What is the English name of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: The English name of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid. |
| Q: What is the CAS number of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: CAS number of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 1410183-01-5. |
| Q: What is the molecular weight of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: Molecular weight of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 237.21. |
| Q: What is the Chinese name of 1410183-01-5? |
| A: Chinese name of 1410183-01-5 is 1410183-01-5. |
| Q: What is the InChIKey of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: InChIKey of 5-Hydroxy-2-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is NHVUZWBFTBIVET-UHFFFAOYSA-N. |