2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid
Modify Date: 2026-09-15 23:53:42
![2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid Structure](https://www.chemsrc.com/extcaspic/276/1410183-08-2.png)
2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid structure
|
Common Name | 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1410183-08-2 | Molecular Weight | 249.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO4 |
|---|---|
| Molecular Weight | 249.26 |
| InChIKey | RDAGREFHUVHAQE-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)Nc1cc(C)c(C)c(C(=O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1410183-08-2? |
| A: Chinese name of 1410183-08-2 is 1410183-08-2. |
| Q: What is the CAS number of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: CAS number of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 1410183-08-2. |
| Q: What is the English name of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: The English name of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid. |
| Q: What is the InChIKey of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: InChIKey of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is RDAGREFHUVHAQE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: Molecular weight of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is 249.26. |
| Q: What is the molecular formula of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: Molecular formula of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is C13H15NO4. |
| Q: What is the SMILES notation of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid? |
| A: SMILES notation of 2,3-Dimethyl-5-{[(prop-2-en-1-yloxy)carbonyl]amino}benzoic acid is C=CCOC(=O)Nc1cc(C)c(C)c(C(=O)O)c1. |