[(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate
![[(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate Structure](https://image.chemsrc.com/caspic/190/141019-70-7.png)
[(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate structure
|
Common Name | [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 141019-70-7 | Molecular Weight | 519.54200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H29NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H29NO8 |
|---|---|
| Molecular Weight | 519.54200 |
| Exact Mass | 519.18900 |
| PSA | 120.39000 |
| LogP | 3.26720 |
| InChIKey | MYVKGGKJMHXHHZ-KPTFLJRUSA-N |
| SMILES | CC(=O)NC1C(OCc2ccccc2)OC(COC(=O)c2ccccc2)C(O)C1OC(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
[(2S,3S,4S,5S,6... CAS#:141019-70-7 |
| Literature: Paulsen, Hans; Rutz, Volker; Brockhausen, Inka Liebigs Annalen der Chemie, 1992 , # 7 p. 735 - 746 |
|
~%
[(2S,3S,4S,5S,6... CAS#:141019-70-7 |
| Literature: Carbohydrate Research, , vol. 326, # 4 p. 250 - 263 |
|
~%
[(2S,3S,4S,5S,6... CAS#:141019-70-7 |
| Literature: Carbohydrate Research, , vol. 326, # 4 p. 250 - 263 |
|
~%
[(2S,3S,4S,5S,6... CAS#:141019-70-7 |
| Literature: Carbohydrate Research, , vol. 326, # 4 p. 250 - 263 |
![[(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate structure](https://image.chemsrc.com/caspic/481/82827-77-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:290819-73-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: The English name of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate. |
| Q: What are the downstream products of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: Related downstream products(CAS) of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate: 290819-73-7. |
| Q: What is the molecular formula of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: Molecular formula of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is C29H29NO8. |
| Q: What are the upstream materials of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: Related upstream materials(CAS) of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate: 82827-77-8;13343-62-9;98-88-4. |
| Q: What is the molecular weight of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: Molecular weight of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is 519.54200. |
| Q: What is the LogP of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: LogP of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is 3.26720. |
| Q: What is the CAS number of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: CAS number of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is 141019-70-7. |
| Q: What is the SMILES notation of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: SMILES notation of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is CC(=O)NC1C(OCc2ccccc2)OC(COC(=O)c2ccccc2)C(O)C1OC(=O)c1ccccc1. |
| Q: What is the polar surface area (PSA) of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: Polar surface area (PSA) of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is 120.39000. |
| Q: What is the InChIKey of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate? |
| A: InChIKey of [(2S,3S,4S,5S,6R)-5-acetamido-4-benzoyloxy-3-hydroxy-6-phenylmethoxyoxan-2-yl]methyl benzoate is MYVKGGKJMHXHHZ-KPTFLJRUSA-N. |