4-chloro-4-(4-methylphenyl)sulfonyl-1-phenylpentan-3-one structure
|
Common Name | 4-chloro-4-(4-methylphenyl)sulfonyl-1-phenylpentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 141036-83-1 | Molecular Weight | 350.86000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-4-(4-methylphenyl)sulfonyl-1-phenylpentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H19ClO3S |
|---|---|
| Molecular Weight | 350.86000 |
| Exact Mass | 350.07400 |
| PSA | 59.59000 |
| LogP | 5.00640 |
| InChIKey | WMVURFZWGMJANR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(C)(Cl)C(=O)CCc2ccccc2)cc1 |
|
~%
4-chloro-4-(4-m... CAS#:141036-83-1 |
| Literature: Satoh, Tsuyoshi; Shishikura, Jun-ichi; Hayashi, Yasumasa; Yamakawa, Koji Chemistry Letters, 1992 , # 3 p. 381 - 384 |
|
~%
4-chloro-4-(4-m... CAS#:141036-83-1 |
| Literature: Satoh, Tsuyoshi; Shishikura, Jun-ichi; Hayashi, Yasumasa; Yamakawa, Koji Chemistry Letters, 1992 , # 3 p. 381 - 384 |
|
~%
4-chloro-4-(4-m... CAS#:141036-83-1 |
| Literature: Satoh, Tsuyoshi; Oguro, Kazuko; Shishikura, Jun-ichi; Kanetaka, Naomi; Okada, Reiko; Yamakawa, Koji Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 8 p. 2339 - 2347 |
| 3-Pentanone,4-chloro-4-[(4-methylphenyl)sulfonyl]-1-phenyl |
| 2-chloro-2-(p-tolylsulfonyl)-5-phenyl-3-pentanone |