3,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)hexane-3,4-diol structure
|
Common Name | 3,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)hexane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 141075-83-4 | Molecular Weight | 526.79000 | |
| Density | 1.034g/cm3 | Boiling Point | 548.8ºC at 760mmHg | |
| Molecular Formula | C34H54O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 3,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)hexane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.034g/cm3 |
|---|---|
| Boiling Point | 548.8ºC at 760mmHg |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.79000 |
| Flash Point | 205.8ºC |
| Exact Mass | 526.40200 |
| PSA | 80.92000 |
| LogP | 8.18320 |
| Vapour Pressure | 7.04E-13mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | QXARPYSNDQRSAK-UHFFFAOYSA-N |
| SMILES | CCC(O)(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(O)(CC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|
~72%
3,4-bis(3,5-dit... CAS#:141075-83-4 |
| Literature: Journal of Organic Chemistry USSR (English Translation), , vol. 27, # 11.2 p. 2115 - 2119 Zhurnal Organicheskoi Khimii, , vol. 27, # 11 p. 2382 - 2388 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 3,4-Bis(3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)-2,4-hexanediol |
| 3,4-bis(3,5-di-tert-butyl-4-hydroxyphenyl)-3,4-hexanediol |
| 2,4-Hexanediol,3,4-bis(3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl) |
| 3,4-bis[3,5-bis(tert-butyl)-4-hydroxyphenyl]hexane-3,4-diol |
| 3,4-Bis(3,5-di(tert-butyl)-4-hydroxyphenyl)hexane-2,4-diol |