4-(5-((4-Methylphenoxy)methyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-y l)pyridine
4-(5-((4-Methylphenoxy)methyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-y l)pyridine structure
|
Common Name | 4-(5-((4-Methylphenoxy)methyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-y l)pyridine | ||
|---|---|---|---|---|
| CAS Number | 141079-05-2 | Molecular Weight | 356.42000 | |
| Density | 1.17g/cm3 | Boiling Point | 591.9ºC at 760mmHg | |
| Molecular Formula | C22H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.8ºC | |
Summary: 4-(5-((4-Methylphenoxy)methyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl)pyridine, with a molecular formula of C22H20N4O and a molecular weight of 356.42000, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 591.9ºC at 760mmHg |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.42000 |
| Flash Point | 311.8ºC |
| Exact Mass | 356.16400 |
| PSA | 52.83000 |
| LogP | 4.52510 |
| Vapour Pressure | 5.52E-14mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | XJSCRALNUGHQKA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2nnc(-c3ccncc3)n2-c2ccc(C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(5-((4-METHYLPHENOXY)METHYL)-4-(4-METHYLPHENYL)-4H-1,2,4-TRIAZOL-3-Y L)PYRIDINE |
| Pyridine,4-(5-((4-methylphenoxy)methyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 141079-05-2? |
| A: Chinese name of 141079-05-2 is 141079-05-2. |
| Q: What is the CAS number of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: CAS number of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is 141079-05-2. |
| Q: What is the English name of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: The English name of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine. |
| Q: What is the InChIKey of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: InChIKey of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is XJSCRALNUGHQKA-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: Related upstream materials(CAS) of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine: 106-44-5;141079-21-2;141079-26-7;16634-82-5;54-85-3. |
| Q: What is the SMILES notation of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: SMILES notation of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is Cc1ccc(OCc2nnc(-c3ccncc3)n2-c2ccc(C)cc2)cc1. |
| Q: What is the polar surface area (PSA) of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: Polar surface area (PSA) of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is 52.83000. |
| Q: What is the LogP of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: LogP of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is 4.52510. |
| Q: What is the boiling point of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: Boiling point of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is 591.9ºC at 760mmHg. |
| Q: What is the molecular formula of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine? |
| A: Molecular formula of 4-[5-[(4-methylphenoxy)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]pyridine is C22H20N4O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |