7-0-Acetylcytochalasin A
Modify Date: 2025-09-10 11:25:53
7-0-Acetylcytochalasin A structure
|
Common Name | 7-0-Acetylcytochalasin A | ||
|---|---|---|---|---|
| CAS Number | 14110-65-7 | Molecular Weight | 519.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H37NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-0-Acetylcytochalasin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H37NO6 |
|---|---|
| Molecular Weight | 519.6 |
| InChIKey | XVNAUIOFBUINAK-QNEGYPHMSA-N |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23OC(=O)C=CC(=O)CCCC(C)CC=CC3C1OC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 7-0-Acetylcytochalasin A? |
| A: InChIKey of 7-0-Acetylcytochalasin A is XVNAUIOFBUINAK-QNEGYPHMSA-N. |
| Q: What is the CAS number of 7-0-Acetylcytochalasin A? |
| A: CAS number of 7-0-Acetylcytochalasin A is 14110-65-7. |
| Q: What is the molecular weight of 7-0-Acetylcytochalasin A? |
| A: Molecular weight of 7-0-Acetylcytochalasin A is 519.6. |
| Q: What is the Chinese name of 14110-65-7? |
| A: Chinese name of 14110-65-7 is 14110-65-7. |
| Q: What is the English name of 7-0-Acetylcytochalasin A? |
| A: The English name of 7-0-Acetylcytochalasin A is 7-0-Acetylcytochalasin A. |
| Q: What is the SMILES notation of 7-0-Acetylcytochalasin A? |
| A: SMILES notation of 7-0-Acetylcytochalasin A is C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23OC(=O)C=CC(=O)CCCC(C)CC=CC3C1OC(C)=O. |
| Q: What is the molecular formula of 7-0-Acetylcytochalasin A? |
| A: Molecular formula of 7-0-Acetylcytochalasin A is C31H37NO6. |