18-HEPE structure
|
Common Name | 18-HEPE | ||
|---|---|---|---|---|
| CAS Number | 141110-17-0 | Molecular Weight | 318.450 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 488.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±25.2 °C | |
| Name | 18-hydroxyicosa-5,8,11,14,16-pentaenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.0±45.0 °C at 760 mmHg |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.450 |
| Flash Point | 263.1±25.2 °C |
| Exact Mass | 318.219482 |
| PSA | 57.53000 |
| LogP | 4.54 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | LRWYBGFSVUBWMO-UXNZXXPISA-N |
| SMILES | CCC(O)C=CC=CCC=CCC=CCC=CCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 18-HEPE |
| 5,8,11,14,16-Eicosapentaenoic acid, 18-hydroxy-, (5Z,8Z,11Z,14Z,16E)- |
| 5,8,11,14,16-Eicosapentaenoic acid,18-hydroxy |
| (5Z,8Z,11Z,14Z,16E)-18-Hydroxy-5,8,11,14,16-icosapentaenoic acid |