1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane structure
|
Common Name | 1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane | ||
|---|---|---|---|---|
| CAS Number | 14115-45-8 | Molecular Weight | 373.98600 | |
| Density | 2.034 g/cm3 | Boiling Point | 51-55ºC 86mm | |
| Molecular Formula | C6H4F9I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58.3ºC | |
| Name | 1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.034 g/cm3 |
|---|---|
| Boiling Point | 51-55ºC 86mm |
| Molecular Formula | C6H4F9I |
| Molecular Weight | 373.98600 |
| Flash Point | 58.3ºC |
| Exact Mass | 373.92100 |
| LogP | 4.48480 |
| Vapour Pressure | 4.98mmHg at 25°C |
| Index of Refraction | 1.3902 |
| InChIKey | GKBGDCARGTVCJU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(CCI)(C(F)(F)F)C(F)(F)F |
| HS Code | 2903799090 |
|---|
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1-trifluoro-4-iodo-2,2-bis-trifluoromethyl-butane |
| 1-Iodo-4,4,4-trifluoro-3,3-bis(trifluoromethyl) |
| 1-iodo-4,4,4-trifluoro-3,3-bis(trifluoromethyl)butane |
| 4,4,4-trifluoro-3,3-bis(trifluoromethyl)-1-iodobutane |