N,N'-Bis[2-[ethyl(3-methylphenyl)amino]ethyl]-1,2-dithioxoethane-1,2-diamine structure
|
Common Name | N,N'-Bis[2-[ethyl(3-methylphenyl)amino]ethyl]-1,2-dithioxoethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 14118-02-6 | Molecular Weight | 418.66200 | |
| Density | 1.15g/cm3 | Boiling Point | 567.5ºC at 760mmHg | |
| Molecular Formula | C22H34N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297ºC | |
| Name | N,N'-bis[2-[cyclohexa-1,4-dien-1-yl(ethyl)amino]ethyl]ethanedithioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 567.5ºC at 760mmHg |
| Molecular Formula | C22H34N4S2 |
| Molecular Weight | 418.66200 |
| Flash Point | 297ºC |
| Exact Mass | 418.22200 |
| PSA | 94.72000 |
| LogP | 4.71380 |
| Vapour Pressure | 6.78E-13mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | QLHIIBDEEMJKLA-UHFFFAOYSA-N |
| SMILES | CCN(CCNC(=S)C(=S)NCCN(CC)C1=CCC=CC1)C1=CCC=CC1 |
| HS Code | 2930909090 |
|---|
|
~%
N,N'-Bis[2-[eth... CAS#:14118-02-6 |
| Literature: Hurd,R.N. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 3980 - 3987 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| USAF MK-67 |
| N,N'-Bis(2-(N-ethyl-m-toluidine)ethyl)-dithiooxamide |
| OXAMIDE,N,N'-BIS(2-(N-ETHYL-m-TOLUIDINO)ETHYL)DITHIO |
| N.N'Bis-[2-(N-aethyl-m-toluidino-aethyl)-dithiooxamid |