1,2,4-trichlorophenothiazin-3-one structure
|
Common Name | 1,2,4-trichlorophenothiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 14118-06-0 | Molecular Weight | 316.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H4Cl3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,4-trichlorophenothiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H4Cl3NOS |
|---|---|
| Molecular Weight | 316.59000 |
| Exact Mass | 314.90800 |
| PSA | 58.20000 |
| LogP | 4.72150 |
| InChIKey | ORQOVBLROKWFDO-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c2sc3ccccc3nc-2c(Cl)c1Cl |
|
~%
1,2,4-trichloro... CAS#:14118-06-0 |
| Literature: Mital,R.L.; Jain,S.K. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 1875 - 1878 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,4-Trichloro-3H-phenothiazin-3-one |
| 1,2,4-Trichloro-3H-phenothiazin-3-on |
| 3H-Phenothiazin-3-one,1,2,4-trichloro |
| 1,2,4-trichloro-phenothiazin-3-one |