8-chloro-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole structure
|
Common Name | 8-chloro-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole | ||
|---|---|---|---|---|
| CAS Number | 14120-24-2 | Molecular Weight | 223.72200 | |
| Density | 1.397g/cm3 | Boiling Point | 413.5ºC at 760 mmHg | |
| Molecular Formula | C11H10ClNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 8-chloro-1,3,4,5-tetrahydrothiopyrano[4,3-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760 mmHg |
| Molecular Formula | C11H10ClNS |
| Molecular Weight | 223.72200 |
| Flash Point | 203.9ºC |
| Exact Mass | 223.02200 |
| PSA | 41.09000 |
| LogP | 3.61060 |
| Vapour Pressure | 1.14E-06mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | YRXCTTFWTHHYGE-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CSCC3 |
|
~%
8-chloro-1,3,4,... CAS#:14120-24-2 |
| Literature: Young,T.E. et al. Journal of Organic Chemistry, 1967 , vol. 32, p. 3622 - 3626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-chloro-1,3,4,5-tetrahydro-thiopyrano[4,3-b]indole |