(4-methoxyphenyl) 3-(4-methoxyphenyl)prop-2-enoate
Modify Date: 2025-08-25 15:34:44
(4-methoxyphenyl) 3-(4-methoxyphenyl)prop-2-enoate structure
|
Common Name | (4-methoxyphenyl) 3-(4-methoxyphenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 141220-41-9 | Molecular Weight | 284.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl) 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O4 |
|---|---|
| Molecular Weight | 284.30700 |
| Exact Mass | 284.10500 |
| PSA | 44.76000 |
| LogP | 3.32260 |
| InChIKey | BBBQWNHYCRZIKV-LFYBBSHMSA-N |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc(OC)cc2)cc1 |
|
~%
(4-methoxypheny... CAS#:141220-41-9 |
| Literature: Doshi, A.V.; Joshi, N.N. Journal of the Indian Chemical Society, 1993 , vol. 70, # 10 p. 807 - 810 |
|
~%
(4-methoxypheny... CAS#:141220-41-9 |
| Literature: Chamchaang, Wilaiporn; Chantarasiri, Nuanphun; Chaona, Somdej; Thebtaranonth, Chachanat; Thebtaranonth, Yodhathai Tetrahedron, 1984 , vol. 40, # 10 p. 1727 - 1730 |
| 4-methoxyphenyl 4-methoxycinnamate |
| p-methoxyphenyl p''-methoxycinnamate |
| 4-Methoxy-trans-zimtsaeure-(4-methoxy-phenylester) |
| 4''-methoxyphenyl (E)-3-(4'-methoxyphenyl)propenoate |
| 4-methoxy-trans-cinnamic acid-(4-methoxy-phenyl ester) |
| 2-Propenoic acid,3-(4-methoxyphenyl)-,4-methoxyphenyl ester,(E) |