Z-Val-Lys-Met-AMC acetate salt structure
|
Common Name | Z-Val-Lys-Met-AMC acetate salt | ||
|---|---|---|---|---|
| CAS Number | 141223-71-4 | Molecular Weight | 667.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H45N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Val-Lys-Met-AMC acetate saltZ-Val-Lys-Met-AMC is a fluorescent substrate that can be used to detect the β-secretase activity of cathepsin B[1]. |
| Name | benzyl N-[1-[[6-amino-1-[[1-[(4-methyl-2-oxochromen-7-yl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Val-Lys-Met-AMC is a fluorescent substrate that can be used to detect the β-secretase activity of cathepsin B[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H45N5O7S |
|---|---|
| Molecular Weight | 667.82 |
| Exact Mass | 667.30400 |
| PSA | 207.16000 |
| LogP | 5.78860 |
| InChIKey | QVSKZGQYQLYCFO-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| Z-Val-Lys-Met-MCA |
| Z-Val-Lys-Met 7-amido-4-methylcoumarin |