benzhydryl 3-methylbutanoate structure
|
Common Name | benzhydryl 3-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 141235-52-1 | Molecular Weight | 268.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzhydryl 3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20O2 |
|---|---|
| Molecular Weight | 268.35000 |
| Exact Mass | 268.14600 |
| PSA | 26.30000 |
| LogP | 4.36530 |
| InChIKey | UBJZUINOHHZITM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)OC(c1ccccc1)c1ccccc1 |
|
~%
benzhydryl 3-me... CAS#:141235-52-1 |
| Literature: Poon, Nai L.; Satchell, Derek P. N. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 6 p. 1083 - 1088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,3-methyl-,diphenylmethyl ester |