Ethyl 2-(3-methoxyphenoxy)propanoate structure
|
Common Name | Ethyl 2-(3-methoxyphenoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 141289-99-8 | Molecular Weight | 224.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(3-methoxyphenoxy)propanoate |
|---|
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.25300 |
| Exact Mass | 224.10500 |
| PSA | 44.76000 |
| LogP | 2.02560 |
| InChIKey | HZWBLFWDSWTRPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1cccc(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl 2-(3-meth... CAS#:141289-99-8 |
| Literature: Curd; Robertson Journal of the Chemical Society, 1933 , p. 714,718 |
|
~69%
Ethyl 2-(3-meth... CAS#:141289-99-8 |
| Literature: Carocci, Alessia; Catalano, Alessia; Lovece, Angelo; Lentini, Giovanni; Duranti, Andrea; Lucini, Valeria; Pannacci, Marilou; Scaglione, Francesco; Franchini, Carlo Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 17 p. 6496 - 6511 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |