2-Imidazolidinone,1-[2-[4-[5-fluoro-3-(4-fluorophenyl)-1h-indol-1-yl]-1-piperidinyl]ethyl] structure
|
Common Name | 2-Imidazolidinone,1-[2-[4-[5-fluoro-3-(4-fluorophenyl)-1h-indol-1-yl]-1-piperidinyl]ethyl] | ||
|---|---|---|---|---|
| CAS Number | 141306-44-7 | Molecular Weight | 424.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26F2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Imidazolidinone,1-[2-[4-[5-fluoro-3-(4-fluorophenyl)-1h-indol-1-yl]-1-piperidinyl]ethyl] |
|---|
| Molecular Formula | C24H26F2N4O |
|---|---|
| Molecular Weight | 424.5 |
| InChIKey | FKZJBKNKELKMSE-UHFFFAOYSA-N |
| SMILES | O=C1NCCN1CCN1CCC(n2cc(-c3ccc(F)cc3)c3cc(F)ccc32)CC1 |
|
Name: Displacement of [3H]spiperone from Dopamine receptor D2 rat striatal membranes
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL673347
|
|
Name: Displacement of [3H]ketanserin from 5-hydroxytryptamine 2 receptor in rat cortical me...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2B
External Id: CHEMBL616503
|
|
Name: Displacement of [3H]prazosin from Alpha-1 adrenergic receptor in whole rat brain memb...
Source: ChEMBL
Target: Alpha-1A adrenergic receptor
External Id: CHEMBL643609
|