methyl 3-(4-fluorophenyl)-5-methyl-1H-indole-2-carboxylate structure
|
Common Name | methyl 3-(4-fluorophenyl)-5-methyl-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 141327-54-0 | Molecular Weight | 283.29700 | |
| Density | 1.256g/cm3 | Boiling Point | 476.4ºC at 760 mmHg | |
| Molecular Formula | C17H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.9ºC | |
| Name | methyl 3-(4-fluorophenyl)-5-methyl-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 476.4ºC at 760 mmHg |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.29700 |
| Flash Point | 241.9ºC |
| Exact Mass | 283.10100 |
| PSA | 42.09000 |
| LogP | 4.06900 |
| Vapour Pressure | 3.06E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | TVRIEWUGJXZDQN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1[nH]c2ccc(C)cc2c1-c1ccc(F)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 5-methyl-3-(4-fluorophenyl)-1H-indole-2-carboxylate |
| 1H-Indole-2-carboxylicacid,3-(4-fluorophenyl)-5-methyl-,methyl ester |
| METHYL 3-(4-FLUOROPHENYL)-5-METHYLINDOLE-2-CARBOXYLATE |