7,7-Dimethyl-6,8-dioxaspiro[3.5]nonan-2-ol
Modify Date: 2024-04-11 10:25:54
![7,7-Dimethyl-6,8-dioxaspiro[3.5]nonan-2-ol Structure](https://image.chemsrc.com/caspic/108/141352-52-5.png)
7,7-Dimethyl-6,8-dioxaspiro[3.5]nonan-2-ol structure
|
Common Name | 7,7-Dimethyl-6,8-dioxaspiro[3.5]nonan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 141352-52-5 | Molecular Weight | 172.22200 | |
| Density | 1.13g/cm3 | Boiling Point | 260ºC at 760 mmHg | |
| Molecular Formula | C9H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.1ºC | |
| Name | 7,7-Dimethyl-6,8-dioxaspiro[3.5]nonan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 260ºC at 760 mmHg |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22200 |
| Flash Point | 111.1ºC |
| Exact Mass | 172.11000 |
| PSA | 38.69000 |
| LogP | 0.91040 |
| Vapour Pressure | 0.00182mmHg at 25°C |
| Index of Refraction | 1.5 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,8-dioxaspiro[3.5]nonan-2-ol,7,7-dimethyl |
| InChI=1/C9H16O3/c1-8(2)11-5-9(6-12-8)3-7(10)4-9/h7,10H,3-6H2,1-2H |
| 7,7-dimethyl-6,8-dioxaspiro<3.5>nonan-2-ol |