phenylethylamide of o-nitrophenylsulfonic acid structure
|
Common Name | phenylethylamide of o-nitrophenylsulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 141381-81-9 | Molecular Weight | 306.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenylethylamide of o-nitrophenylsulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O4S |
|---|---|
| Molecular Weight | 306.33700 |
| Exact Mass | 306.06700 |
| PSA | 100.37000 |
| LogP | 4.11070 |
| InChIKey | TYLQUNDUNLQKGK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCc1ccccc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-nitro-N-phenethyl-benzenesulfonamide |