Trachelanthamine structure
|
Common Name | Trachelanthamine | ||
|---|---|---|---|---|
| CAS Number | 14140-18-2 | Molecular Weight | 285.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TrachelanthamineTrachelanthamine is a pyrrolizidine alkaloid isolated from the plant[1]. |
| Name | thrachelanthamine |
|---|---|
| Synonym | More Synonyms |
| Description | Trachelanthamine is a pyrrolizidine alkaloid isolated from the plant[1]. |
|---|---|
| Related Catalog | |
| Target |
Others |
| References |
| Molecular Formula | C15H27NO4 |
|---|---|
| Molecular Weight | 285.38 |
| Exact Mass | 285.19400 |
| PSA | 70.00000 |
| LogP | 0.71970 |
| InChIKey | BWQSLRZZOVFVHJ-OSFYFWSMSA-N |
| SMILES | CC(C)C(O)(C(=O)OCC1CCN2CCCC12)C(C)O |
| coromandaline |
| viridiflorine |
| (2S,3R)-2,3-Dihydroxy-2-isopropyl-buttersaeure-((7aS)-(7ar)-hexahydropyrrolizin-1c-ylmethylester) |
| (2S,3R)-2,3-Dihydroxy-2-isopropyl-butyric acid (1R,7aS)-1-(hexahydro-pyrrolizin-1-yl)methyl ester |
| (2S,3R)-2,3-dihydroxy-2-isopropyl-butyric acid-((7aS)-(7ar)-hexahydropyrrolizin-1c-ylmethyl ester) |
| Lindelofin |