N-Methylcarbamic acid 3-(dimethylamino)-4-methylphenyl ester
N-Methylcarbamic acid 3-(dimethylamino)-4-methylphenyl ester structure
|
Common Name | N-Methylcarbamic acid 3-(dimethylamino)-4-methylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 14144-91-3 | Molecular Weight | 208.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2O2 |
|---|---|
| Molecular Weight | 208.25700 |
| Exact Mass | 208.12100 |
| PSA | 41.57000 |
| LogP | 2.17010 |
| InChIKey | SOANVOIJXGSERP-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccc(C)c(N(C)C)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl-carbamidsaeure-(3-dimethylamino-4-methyl-phenylester) |
| 2-Dimethylamino-4-methylcarbamoyloxy-toluol |
| PHENOL,3-(DIMETHYLAMINO)-4-METHYL-, 1-(N-METHYLCARBAMATE) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: Molecular weight of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is 208.25700. |
| Q: What is the LogP of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: LogP of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is 2.17010. |
| Q: What is the molecular formula of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: Molecular formula of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is C11H16N2O2. |
| Q: What is the CAS number of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: CAS number of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is 14144-91-3. |
| Q: What is the polar surface area (PSA) of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: Polar surface area (PSA) of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is 41.57000. |
| Q: What is the English name of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: The English name of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester). |
| Q: What English synonyms does methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) have? |
| A: English synonyms of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester): Methyl-carbamidsaeure-(3-dimethylamino-4-methyl-phenylester), 2-Dimethylamino-4-methylcarbamoyloxy-toluol, PHENOL,3-(DIMETHYLAMINO)-4-METHYL-, 1-(N-METHYLCARBAMATE). |
| Q: What is the InChIKey of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: InChIKey of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is SOANVOIJXGSERP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 14144-91-3? |
| A: Chinese name of 14144-91-3 is 14144-91-3. |
| Q: What is the SMILES notation of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester)? |
| A: SMILES notation of methyl-carbamic acid-(3-dimethylamino-4-methyl-phenyl ester) is CNC(=O)Oc1ccc(C)c(N(C)C)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |