2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione
Modify Date: 2025-08-26 13:11:09
![2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione Structure](https://www.chemsrc.com/extcaspic/382/14146-05-5.png)
2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione structure
|
Common Name | 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione | ||
|---|---|---|---|---|
| CAS Number | 14146-05-5 | Molecular Weight | 247.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9NO5 |
|---|---|
| Molecular Weight | 247.20 |
| InChIKey | NOOVPMKKYVPTHI-UHFFFAOYSA-N |
| SMILES | CC(O[N+](=O)[O-])C1=CC(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: CAS number of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is 14146-05-5. |
| Q: What is the Chinese name of 14146-05-5? |
| A: Chinese name of 14146-05-5 is 14146-05-5. |
| Q: What is the molecular formula of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: Molecular formula of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is C12H9NO5. |
| Q: What is the InChIKey of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: InChIKey of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is NOOVPMKKYVPTHI-UHFFFAOYSA-N. |
| Q: What is the English name of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: The English name of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione. |
| Q: What is the SMILES notation of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: SMILES notation of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is CC(O[N+](=O)[O-])C1=CC(=O)c2ccccc2C1=O. |
| Q: What is the molecular weight of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione? |
| A: Molecular weight of 2-[1-(Nitrooxy)ethyl]-1,4-naphthalenedione is 247.20. |