methyl 2-(benzenesulfonyl)-3-phenylprop-2-enoate structure
|
Common Name | methyl 2-(benzenesulfonyl)-3-phenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 141508-71-6 | Molecular Weight | 302.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(benzenesulfonyl)-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O4S |
|---|---|
| Molecular Weight | 302.34500 |
| Exact Mass | 302.06100 |
| PSA | 68.82000 |
| LogP | 3.75520 |
| InChIKey | QURLYMRVLNEYGZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=Cc1ccccc1)S(=O)(=O)c1ccccc1 |
|
~77%
methyl 2-(benze... CAS#:141508-71-6 |
| Literature: Chiba, Ryoichi; Oriyama, Takeshi Chemistry Letters, 2008 , vol. 37, # 12 p. 1218 - 1219 |
|
~53%
methyl 2-(benze... CAS#:141508-71-6 |
| Literature: Reddy, G. Ramachandra; Gupta, S. V. S. Aruna Kumar; Reddy, D. Bhaskar; Seenaiah, B. Journal of the Indian Chemical Society, 1992 , vol. 69, # 7 p. 396 - 397 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Propenoic acid,3-phenyl-2-(phenylsulfonyl)-,methyl ester |
| 2-Propenoic acid,3-phenyl-2-(phenylsulfonyl)-,methyl ester,(2E) |
| methyl 3-phenyl-2-(phenylsulfonyl)propenoate |