(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid structure
|
Common Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 141509-91-3 | Molecular Weight | 218.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO4 | Melting Point | 77-80 ℃(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 77-80 ℃(lit.) |
|---|---|
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 218.25600 |
| Exact Mass | 218.12800 |
| PSA | 75.63000 |
| LogP | 2.01120 |
| InChIKey | SZXBQTSZISFIAO-PFGINBISSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
|
~95%
(2S)-3-methyl-2... CAS#:141509-91-3 |
| Literature: Aisenbrey, Christopher; Pendem, Nagendar; Guichard, Gilles; Bechinger, Burkhard Organic and Biomolecular Chemistry, 2012 , vol. 10, # 7 p. 1440 - 1447 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| L-Valine-15N,N-t-Boc derivative |
| Boc-Val-OH-15N |
| N-(tert-Butoxycarbonyl)-L-valine-15N,L-Valine-15N,N-t-Boc derivative |
| 15N-labelled t-Boc-L-valine |