5,8-Quinolinedione,7-amino-6-methoxy- structure
|
Common Name | 5,8-Quinolinedione,7-amino-6-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 14151-19-0 | Molecular Weight | 204.18200 | |
| Density | 1.42g/cm3 | Boiling Point | 389.7ºC at 760mmHg | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | 7-amino-6-methoxyquinoline-5,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760mmHg |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Flash Point | 189.5ºC |
| Exact Mass | 204.05300 |
| PSA | 82.28000 |
| LogP | 0.97760 |
| Vapour Pressure | 2.79E-06mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | NLVITWPVYZJFCX-UHFFFAOYSA-N |
| SMILES | COC1=C(N)C(=O)c2ncccc2C1=O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-amino-6-methoxy-quinoline-5,8-dione |
| 7-Amino-6-methoxy-5,8-quinolinedione |
| 7-amino-6-methoxyquinoline-5,8-quinone |
| 7-Amino-6-methoxy-5,8-chinolindion |