8-nitro-1,2,3,4,5,6-hexahydrochrysene structure
|
Common Name | 8-nitro-1,2,3,4,5,6-hexahydrochrysene | ||
|---|---|---|---|---|
| CAS Number | 141511-29-7 | Molecular Weight | 279.33300 | |
| Density | 1.242g/cm3 | Boiling Point | 453.6ºC at 760mmHg | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 8-nitro-1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 453.6ºC at 760mmHg |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33300 |
| Flash Point | 214ºC |
| Exact Mass | 279.12600 |
| PSA | 45.82000 |
| LogP | 4.76240 |
| Vapour Pressure | 5.5E-08mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | YNAHHYXTVAAJLP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCc1c-2ccc2c1CCCC2 |
|
~%
8-nitro-1,2,3,4... CAS#:141511-29-7 |
| Literature: Miller, Dwight W.; Herreno-Saenz, Diogenes; Huang, Kurt H.; Heinze, Thomas M.; Fu, Peter P. Journal of Organic Chemistry, 1992 , vol. 57, # 13 p. 3746 - 3748 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Chrysene,7,8,9,10,11,12-hexahydro-2-nitro |
| 7,8,9,10,11,12-Hexahydro-2-nitrochrysene |
| Chrysene,1,2,3,4,5,6-hexahydro-8-nitro |
| Chrysene,1,2,3,4,5,6-hexahydro-8-nitro-(9CI) |
| 2-Nitro-7,8,9,10,11,12-hexahydrochrysene |