Lapatinib metabolite M6
Modify Date: 2026-07-16 21:24:55
Lapatinib metabolite M6 structure
|
Common Name | Lapatinib metabolite M6 | ||
|---|---|---|---|---|
| CAS Number | 1415561-66-8 | Molecular Weight | 595.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H24ClFN4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Lapatinib metabolite M6 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H24ClFN4O5S |
|---|---|
| Molecular Weight | 595.0 |
| InChIKey | PBJRBJIUNALOPK-VOEWZCDUSA-N |
| SMILES | CS(=O)(=O)CCN(O)C=c1ccc(=c2ccc3c(c2)C(=Nc2ccc(OCc4cccc(F)c4)c(Cl)c2)N=CN=3)o1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 8, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Lapatinib metabolite M6? |
| A: InChIKey of Lapatinib metabolite M6 is PBJRBJIUNALOPK-VOEWZCDUSA-N. |
| Q: What is the CAS number of Lapatinib metabolite M6? |
| A: CAS number of Lapatinib metabolite M6 is 1415561-66-8. |
| Q: What is the English name of Lapatinib metabolite M6? |
| A: The English name of Lapatinib metabolite M6 is Lapatinib metabolite M6. |
| Q: What is the molecular formula of Lapatinib metabolite M6? |
| A: Molecular formula of Lapatinib metabolite M6 is C29H24ClFN4O5S. |
| Q: What is the molecular weight of Lapatinib metabolite M6? |
| A: Molecular weight of Lapatinib metabolite M6 is 595.0. |
| Q: What is the Chinese name of 1415561-66-8? |
| A: Chinese name of 1415561-66-8 is 1415561-66-8. |
| Q: What is the SMILES notation of Lapatinib metabolite M6? |
| A: SMILES notation of Lapatinib metabolite M6 is CS(=O)(=O)CCN(O)C=c1ccc(=c2ccc3c(c2)C(=Nc2ccc(OCc4cccc(F)c4)c(Cl)c2)N=CN=3)o1. |