1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine
Modify Date: 2025-09-13 19:16:04
1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine structure
|
Common Name | 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 14164-27-3 | Molecular Weight | 235.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17N |
|---|---|
| Molecular Weight | 235.32 |
| InChIKey | YNOGNWHWEYCRBD-UHFFFAOYSA-N |
| SMILES | CC(=C1c2ccccc2-c2ccccc21)N(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: The English name of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine. |
| Q: What is the CAS number of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: CAS number of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is 14164-27-3. |
| Q: What is the InChIKey of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: InChIKey of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is YNOGNWHWEYCRBD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: SMILES notation of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is CC(=C1c2ccccc2-c2ccccc21)N(C)C. |
| Q: What is the Chinese name of 14164-27-3? |
| A: Chinese name of 14164-27-3 is 14164-27-3. |
| Q: What is the molecular formula of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: Molecular formula of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is C17H17N. |
| Q: What is the molecular weight of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine? |
| A: Molecular weight of 1-(9H-Fluoren-9-ylidene)-N,N-dimethylethanamine is 235.32. |