2-Butyl-3-(4-hydroxybenzoyl)-5-nitrobenzofuran structure
|
Common Name | 2-Butyl-3-(4-hydroxybenzoyl)-5-nitrobenzofuran | ||
|---|---|---|---|---|
| CAS Number | 141645-16-1 | Molecular Weight | 339.342 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 559.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.2±30.1 °C | |
| Name | (2-Butyl-5-nitrobenzofuran-3-yl)(4-hydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.5±50.0 °C at 760 mmHg |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.342 |
| Flash Point | 292.2±30.1 °C |
| Exact Mass | 339.110687 |
| PSA | 96.26000 |
| LogP | 5.10 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ZJZKLBXEGZKOBW-UHFFFAOYSA-N |
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(O)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2932999099 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| T56 BOJ C4 DVR DQ& GNW |
| (2-Butyl-5-nitro-1-benzofuran-3-yl)(4-hydroxyphenyl)methanone |
| 2-Butyl-3-(4-hydroxybenzoyl)-5-nitrobenzofuran |
| Methanone, (2-butyl-5-nitro-3-benzofuranyl)(4-hydroxyphenyl)- |
| (2-butyl-5-nitro-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone |
| Dronedarone Impurity 4 |