(7α)-Methyl Androstenedione 3-Ethylene Ketal structure
|
Common Name | (7α)-Methyl Androstenedione 3-Ethylene Ketal | ||
|---|---|---|---|---|
| CAS Number | 141664-12-2 | Molecular Weight | 330.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (7R,8R,9S,13S,14S)-7,13-dimethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|
| Molecular Formula | C21H30O3 |
|---|---|
| Molecular Weight | 330.46100 |
| Exact Mass | 330.21900 |
| PSA | 35.53000 |
| LogP | 4.26140 |
| InChIKey | XNJSTNUYCHRSRZ-HIHRSEIJSA-N |
| SMILES | CC1CC2=C(CCC3(C2)OCCO3)C2CCC3(C)C(=O)CCC3C12 |
|
~89%
(7α)-Methyl And... CAS#:141664-12-2 |
| Literature: Liu; Carlson; Katzenellenbogen Journal of Medicinal Chemistry, 1992 , vol. 35, # 11 p. 2113 - 2129 |
|
~%
(7α)-Methyl And... CAS#:141664-12-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 11 p. 2113 - 2129 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |