6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine
Modify Date: 2026-07-08 18:09:24
![6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine Structure](https://www.chemsrc.com/extcaspic/201/1417618-37-1.png)
6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine structure
|
Common Name | 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1417618-37-1 | Molecular Weight | 288.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13ClN2O2 |
|---|---|
| Molecular Weight | 288.73 |
| InChIKey | LPHYYJOBQUINSS-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(-c2nc3cnc(Cl)cc3o2)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1417618-37-1? |
| A: Chinese name of 1417618-37-1 is 1417618-37-1. |
| Q: What is the CAS number of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: CAS number of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is 1417618-37-1. |
| Q: What is the InChIKey of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: InChIKey of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is LPHYYJOBQUINSS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: Molecular formula of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is C15H13ClN2O2. |
| Q: What is the English name of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: The English name of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine. |
| Q: What is the molecular weight of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: Molecular weight of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is 288.73. |
| Q: What is the SMILES notation of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine? |
| A: SMILES notation of 6-Chloro-2-(4-methoxy-3,5-dimethylphenyl)oxazolo[4,5-C]pyridine is COc1c(C)cc(-c2nc3cnc(Cl)cc3o2)cc1C. |