Methanone,(1-oxido-4-pyridinyl)phenyl- structure
|
Common Name | Methanone,(1-oxido-4-pyridinyl)phenyl- | ||
|---|---|---|---|---|
| CAS Number | 14178-29-1 | Molecular Weight | 199.20500 | |
| Density | 1.14g/cm3 | Boiling Point | 429.1ºC at 760 mmHg | |
| Molecular Formula | C12H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | (1-oxidopyridin-1-ium-4-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760 mmHg |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.20500 |
| Flash Point | 213.3ºC |
| Exact Mass | 199.06300 |
| PSA | 42.53000 |
| LogP | 2.34610 |
| Vapour Pressure | 1.44E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | UQNSTGILJBPJQN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc[n+]([O-])cc1 |
|
~%
Methanone,(1-ox... CAS#:14178-29-1 |
| Literature: Lorance, Edward D.; Kramer, Wolfgang H.; Gould, Ian R. Journal of the American Chemical Society, 2002 , vol. 124, # 51 p. 15225 - 15238 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 4-benzoylpyridine-N-oxide |
| 4-benzoylpyridine oxide |