α-(2-Amino-1-methylethyl)-4-methyl-α-(4-methylphenyl)benzenemethanol structure
|
Common Name | α-(2-Amino-1-methylethyl)-4-methyl-α-(4-methylphenyl)benzenemethanol | ||
|---|---|---|---|---|
| CAS Number | 14185-12-7 | Molecular Weight | 269.38100 | |
| Density | 1.063g/cm3 | Boiling Point | 446.3ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.7ºC | |
| Name | 3-amino-2-methyl-1,1-bis(4-methylphenyl)propan-1-ol |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 446.3ºC at 760 mmHg |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 223.7ºC |
| Exact Mass | 269.17800 |
| PSA | 46.25000 |
| LogP | 3.83440 |
| Vapour Pressure | 9.53E-09mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | IDJRHRZFEWCOGC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(C)CN)cc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |