2-methyl-3-(methylamino)-1,1-diphenylpropan-1-ol,hydrochloride structure
|
Common Name | 2-methyl-3-(methylamino)-1,1-diphenylpropan-1-ol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 14185-24-1 | Molecular Weight | 291.81600 | |
| Density | N/A | Boiling Point | 411.6ºC at 760 mmHg | |
| Molecular Formula | C17H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | 2-methyl-3-(methylamino)-1,1-diphenylpropan-1-ol,hydrochloride |
|---|
| Boiling Point | 411.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.81600 |
| Flash Point | 120.5ºC |
| Exact Mass | 291.13900 |
| PSA | 32.26000 |
| LogP | 3.97090 |
| Vapour Pressure | 1.63E-07mmHg at 25°C |
| InChIKey | JDIIJTZDRPIWAP-UHFFFAOYSA-N |
| SMILES | CNCC(C)C(O)(c1ccccc1)c1ccccc1.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |