2-Nitrocarbazole structure
|
Common Name | 2-Nitrocarbazole | ||
|---|---|---|---|---|
| CAS Number | 14191-22-1 | Molecular Weight | 212.20400 | |
| Density | 1.435g/cm3 | Boiling Point | 448.6ºC at 760mmHg | |
| Molecular Formula | C12H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 2-nitro-9h-carbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760mmHg |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.20400 |
| Flash Point | 225.1ºC |
| Exact Mass | 212.05900 |
| PSA | 61.61000 |
| LogP | 3.75250 |
| Vapour Pressure | 8.12E-08mmHg at 25°C |
| Index of Refraction | 1.795 |
| InChIKey | RSSFRJAJZYDBDI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-nitro-9H-carbazol |
| nitro-2 carbazole |
| 2-Nitrocarbazol |
| 9H-Carbazole,2-nitro |
| 2-Nitrocarbazole |
| Carbazole,2-nitro |
| 3-Nitrocarbazol |