dipyrrolidin-1-ylphosphoryl 3-chlorobenzoate structure
|
Common Name | dipyrrolidin-1-ylphosphoryl 3-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 141931-27-3 | Molecular Weight | 342.75800 | |
| Density | 1.35g/cm3 | Boiling Point | 459.9ºC at 760mmHg | |
| Molecular Formula | C15H20ClN2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
| Name | dipyrrolidin-1-ylphosphoryl 3-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760mmHg |
| Molecular Formula | C15H20ClN2O3P |
| Molecular Weight | 342.75800 |
| Flash Point | 231.9ºC |
| Exact Mass | 342.09000 |
| PSA | 59.66000 |
| LogP | 3.67230 |
| Vapour Pressure | 1.22E-08mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | QABXMNOVGVUNFV-UHFFFAOYSA-N |
| SMILES | O=C(OP(=O)(N1CCCC1)N1CCCC1)c1cccc(Cl)c1 |
| Benzoic acid,3-chloro-,anhydride with di-1-pyrrolidinylphosphinic acid |