2,4-dibromo-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one structure
|
Common Name | 2,4-dibromo-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 141938-49-0 | Molecular Weight | 324.00900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dibromo-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12Br2O2 |
|---|---|
| Molecular Weight | 324.00900 |
| Exact Mass | 321.92000 |
| PSA | 26.30000 |
| LogP | 2.44590 |
| InChIKey | CDIISVSETOHOGY-UHFFFAOYSA-N |
| SMILES | CC(C)C1(Br)C(=O)C(Br)C2C=CC1O2 |
|
~51%
2,4-dibromo-4-p... CAS#:141938-49-0 |
| Literature: Mann, John; Barbosa, Luiz-Claudio de Almeida Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 7 p. 787 - 790 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-dibromo-2-isopropyl-8-oxabicyclo<3.2.1>oct-6-en-3-one |