[diazo(trimethylstannyl)methyl]-tri(propan-2-yl)silane structure
|
Common Name | [diazo(trimethylstannyl)methyl]-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 141958-17-0 | Molecular Weight | 364.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H33N2SiSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [diazo(trimethylstannyl)methyl]-tri(propan-2-yl)silane |
|---|
| Molecular Formula | C13H33N2SiSn |
|---|---|
| Molecular Weight | 364.20100 |
| Exact Mass | 365.14300 |
| PSA | 13.60000 |
| LogP | 4.77488 |
| InChIKey | MWRAOHDVPJRUMF-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(=[N+]=[N-])[Sn](C)(C)C)(C(C)C)C(C)C |
|
~55%
[diazo(trimethy... CAS#:141958-17-0 |
| Literature: Reau, Regis; Veneziani, Guilaine; Bertrand, Guy Journal of the American Chemical Society, 1992 , vol. 114, # 15 p. 6059 - 6063 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |